C17H21ClN4O2Si — CID 136640945
3-(6-chloropyrimidin-4-yl)-2-(2-trimethylsilylethoxymethyl)indazol-5-ol (PubChem CID 136640945) has the molecular formula C17H21ClN4O2Si and a molecular weight of 376.92 g/mol. Its IUPAC name is 3-(6-chloropyrimidin-4-yl)-2-(2-trimethylsilylethoxymethyl)indazol-5-ol.
| Compound Name | 3-(6-chloropyrimidin-4-yl)-2-(2-trimethylsilylethoxymethyl)indazol-5-ol |
|---|---|
| PubChem CID | 136640945 |
| Molecular Formula | C17H21ClN4O2Si |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3-(6-chloropyrimidin-4-yl)-2-(2-trimethylsilylethoxymethyl)indazol-5-ol |
| SMILES | C[Si](C)(C)CCOCn1nc2ccc(O)cc2c1-c1cc(Cl)ncn1 |
| InChI | InChI=1S/C17H21ClN4O2Si/c1-25(2,3)7-6-24-11-22-17(15-9-16(18)20-10-19-15)13-8-12(23)4-5-14(13)21-22/h4-5,8-10,23H,6-7,11H2,1-3H3 |
| InChIKey | XZGQRGCCXKMHPE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|