C13H18ClN3O2Si — CID 131736065
7-chloro-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 131736065) has the molecular formula C13H18ClN3O2Si and a molecular weight of 311.84 g/mol. Its IUPAC name is 7-chloro-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-chloro-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 131736065 |
| Molecular Formula | C13H18ClN3O2Si |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 7-chloro-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(Cl)ncc2c1=O |
| InChI | InChI=1S/C13H18ClN3O2Si/c1-20(2,3)5-4-19-9-17-8-16-11-6-12(14)15-7-10(11)13(17)18/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | GHNNQEJZZOBEGU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|