C22H27ClN4O2Si — CID 167374733
2-[[5-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-6-methoxybenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 167374733) has the molecular formula C22H27ClN4O2Si and a molecular weight of 443.02 g/mol. Its IUPAC name is 2-[[5-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-6-methoxybenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-6-methoxybenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167374733 |
| Molecular Formula | C22H27ClN4O2Si |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[[5-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-6-methoxybenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2c(cc1-c1cc3cc(Cl)ncc3n1C)ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H27ClN4O2Si/c1-26-18(8-15-9-22(23)24-12-20(15)26)16-10-17-19(11-21(16)28-2)27(13-25-17)14-29-6-7-30(3,4)5/h8-13H,6-7,14H2,1-5H3 |
| InChIKey | QPYKUWYBGZRZTN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|