C14H21BrN2O2Si — CID 172631194
2-[(6-bromo-5-methoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 172631194) has the molecular formula C14H21BrN2O2Si and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[(6-bromo-5-methoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-bromo-5-methoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172631194 |
| Molecular Formula | C14H21BrN2O2Si |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-[(6-bromo-5-methoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2ncn(COCC[Si](C)(C)C)c2cc1Br |
| InChI | InChI=1S/C14H21BrN2O2Si/c1-18-14-8-12-13(7-11(14)15)17(9-16-12)10-19-5-6-20(2,3)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | NJKHDTFUIWWVQW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|