C13H19FN2OSi — CID 141393470
2-[(6-fluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 141393470) has the molecular formula C13H19FN2OSi and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[(6-fluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-fluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141393470 |
| Molecular Formula | C13H19FN2OSi |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[(6-fluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2ccc(F)cc21 |
| InChI | InChI=1S/C13H19FN2OSi/c1-18(2,3)7-6-17-10-16-9-15-12-5-4-11(14)8-13(12)16/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | OFODJEDQRHGZMG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|