C15H24N2O3Si — CID 67292375
2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 67292375) has the molecular formula C15H24N2O3Si and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67292375 |
| Molecular Formula | C15H24N2O3Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2ncn(COCC[Si](C)(C)C)c2cc1OC |
| InChI | InChI=1S/C15H24N2O3Si/c1-18-14-8-12-13(9-15(14)19-2)17(10-16-12)11-20-6-7-21(3,4)5/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | PMQWAKSBBOFHGB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|