About 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane
2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 67292375) has the molecular formula C15H24N2O3Si
and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| PubChem CID | 67292375 |
| Molecular Formula | C15H24N2O3Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2ncn(COCC[Si](C)(C)C)c2cc1OC |
| InChI | InChI=1S/C15H24N2O3Si/c1-18-14-8-12-13(9-15(14)19-2)17(10-16-12)11-20-6-7-21(3,4)5/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | PMQWAKSBBOFHGB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (CID 67292375) is 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane is COc1cc2ncn(COCC[Si](C)(C)C)c2cc1OC.
What is the InChIKey of 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane?
The InChIKey is PMQWAKSBBOFHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3Si/c1-18-14-8-12-13(9-15(14)19-2)17(10-16-12)11-20-6-7-21(3,4)5/h8-10H,6-7,11H2,1-5H3.
What are the key properties of 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane?
2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane has a molecular weight of 308.45 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 67292375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).