C13H18F2N2OSi — CID 66599822
2-[(5,7-difluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 66599822) has the molecular formula C13H18F2N2OSi and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[(5,7-difluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5,7-difluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66599822 |
| Molecular Formula | C13H18F2N2OSi |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(5,7-difluorobenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C13H18F2N2OSi/c1-19(2,3)5-4-18-9-17-8-16-12-7-10(14)6-11(15)13(12)17/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | OGCFNHYIVVWAJB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|