C19H34N2O3Si2 — CID 67293077
trimethyl-[2-[[7-(2-trimethylsilylethoxymethoxy)benzimidazol-1-yl]methoxy]ethyl]silane (PubChem CID 67293077) has the molecular formula C19H34N2O3Si2 and a molecular weight of 394.66 g/mol. Its IUPAC name is trimethyl-[2-[[7-(2-trimethylsilylethoxymethoxy)benzimidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[7-(2-trimethylsilylethoxymethoxy)benzimidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 67293077 |
| Molecular Formula | C19H34N2O3Si2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | trimethyl-[2-[[7-(2-trimethylsilylethoxymethoxy)benzimidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCOc1cccc2ncn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C19H34N2O3Si2/c1-25(2,3)12-10-22-15-21-14-20-17-8-7-9-18(19(17)21)24-16-23-11-13-26(4,5)6/h7-9,14H,10-13,15-16H2,1-6H3 |
| InChIKey | NKBSRCVKRWYWNQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|