C23H27N3O3Si — CID 175566095
2-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 175566095) has the molecular formula C23H27N3O3Si and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175566095 |
| Molecular Formula | C23H27N3O3Si |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1ccc2c(c1)ncn2COCC[Si](C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H27N3O3Si/c1-16(26-22(27)18-7-5-6-8-19(18)23(26)28)17-9-10-21-20(13-17)24-14-25(21)15-29-11-12-30(2,3)4/h5-10,13-14,16H,11-12,15H2,1-4H3 |
| InChIKey | VQDIEMBIXYIGIZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|