C20H35N3O3SSi — CID 177107936
(4S)-5-methoxy-2-methyl-4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]pentane-2-sulfinamide (PubChem CID 177107936) has the molecular formula C20H35N3O3SSi and a molecular weight of 425.67 g/mol. Its IUPAC name is (4S)-5-methoxy-2-methyl-4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]pentane-2-sulfinamide.
| Compound Name | (4S)-5-methoxy-2-methyl-4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]pentane-2-sulfinamide |
|---|---|
| PubChem CID | 177107936 |
| Molecular Formula | C20H35N3O3SSi |
| Molecular Weight | 425.67 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (4S)-5-methoxy-2-methyl-4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]pentane-2-sulfinamide |
| SMILES | COC[C@@H](CC(C)(C)S(N)=O)c1ccc2c(c1)ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H35N3O3SSi/c1-20(2,27(21)24)12-17(13-25-3)16-7-8-19-18(11-16)22-14-23(19)15-26-9-10-28(4,5)6/h7-8,11,14,17H,9-10,12-13,15,21H2,1-6H3/t17-,27?/m1/s1 |
| InChIKey | LFFCGEJICOBXOW-MOJDWNGGSA-N |
| XLogP | 3.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|