C21H35N3O2SSi — CID 171777693
(S)-N-[cyclopropyl-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methyl]-2-methylpropane-2-sulfinamide (PubChem CID 171777693) has the molecular formula C21H35N3O2SSi and a molecular weight of 421.68 g/mol. Its IUPAC name is (S)-N-[cyclopropyl-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[cyclopropyl-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 171777693 |
| Molecular Formula | C21H35N3O2SSi |
| Molecular Weight | 421.68 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (S)-N-[cyclopropyl-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)NC(c1ccc2c(c1)ncn2COCC[Si](C)(C)C)C1CC1 |
| InChI | InChI=1S/C21H35N3O2SSi/c1-21(2,3)27(25)23-20(16-7-8-16)17-9-10-19-18(13-17)22-14-24(19)15-26-11-12-28(4,5)6/h9-10,13-14,16,20,23H,7-8,11-12,15H2,1-6H3/t20?,27-/m0/s1 |
| InChIKey | MHQAMZLUGQLIGH-OHMHCFLMSA-N |
| XLogP | 4.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|