C21H34F2N2O2SSi — CID 156681762
(R)-N-[(1R)-1-[4-(difluoromethyl)-1-(2-trimethylsilylethoxymethyl)indol-6-yl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 156681762) has the molecular formula C21H34F2N2O2SSi and a molecular weight of 444.66 g/mol. Its IUPAC name is (R)-N-[(1R)-1-[4-(difluoromethyl)-1-(2-trimethylsilylethoxymethyl)indol-6-yl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-[4-(difluoromethyl)-1-(2-trimethylsilylethoxymethyl)indol-6-yl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 156681762 |
| Molecular Formula | C21H34F2N2O2SSi |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (R)-N-[(1R)-1-[4-(difluoromethyl)-1-(2-trimethylsilylethoxymethyl)indol-6-yl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](N[S@](=O)C(C)(C)C)c1cc(C(F)F)c2ccn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C21H34F2N2O2SSi/c1-15(24-28(26)21(2,3)4)16-12-18(20(22)23)17-8-9-25(19(17)13-16)14-27-10-11-29(5,6)7/h8-9,12-13,15,20,24H,10-11,14H2,1-7H3/t15-,28-/m1/s1 |
| InChIKey | WVIXIYJEFVUORO-WQIZZMQYSA-N |
| XLogP | 6.00 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|