C14H19ClN2O3Si — CID 131736189
2-[(6-chloro-4-nitroindol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 131736189) has the molecular formula C14H19ClN2O3Si and a molecular weight of 326.86 g/mol. Its IUPAC name is 2-[(6-chloro-4-nitroindol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-chloro-4-nitroindol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 131736189 |
| Molecular Formula | C14H19ClN2O3Si |
| Molecular Weight | 326.86 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[(6-chloro-4-nitroindol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c([N+](=O)[O-])cc(Cl)cc21 |
| InChI | InChI=1S/C14H19ClN2O3Si/c1-21(2,3)7-6-20-10-16-5-4-12-13(16)8-11(15)9-14(12)17(18)19/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | VYNAAGDKDHLECI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|