C15H21N3O3Si — CID 22018541
trimethyl-[2-[[5-(4-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 22018541) has the molecular formula C15H21N3O3Si and a molecular weight of 319.44 g/mol. Its IUPAC name is trimethyl-[2-[[5-(4-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(4-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 22018541 |
| Molecular Formula | C15H21N3O3Si |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | trimethyl-[2-[[5-(4-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cncc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H21N3O3Si/c1-22(2,3)9-8-21-12-17-11-16-10-15(17)13-4-6-14(7-5-13)18(19)20/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | RBMORIXNTWLWGP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|