C13H20IN3O3Si — CID 151274728
2-[(2-iodo-5-nitro-3H-indazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 151274728) has the molecular formula C13H20IN3O3Si and a molecular weight of 421.31 g/mol. Its IUPAC name is 2-[(2-iodo-5-nitro-3H-indazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-iodo-5-nitro-3H-indazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 151274728 |
| Molecular Formula | C13H20IN3O3Si |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 2-[(2-iodo-5-nitro-3H-indazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCN1c2ccc([N+](=O)[O-])cc2CN1I |
| InChI | InChI=1S/C13H20IN3O3Si/c1-21(2,3)7-6-20-10-15-13-5-4-12(17(18)19)8-11(13)9-16(15)14/h4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | NXCQNXHNNOCVEB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|