C16H20N4O4Si — CID 168728003
trimethyl-[2-[[5-nitro-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl]silane (PubChem CID 168728003) has the molecular formula C16H20N4O4Si and a molecular weight of 360.45 g/mol. Its IUPAC name is trimethyl-[2-[[5-nitro-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-nitro-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 168728003 |
| Molecular Formula | C16H20N4O4Si |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | trimethyl-[2-[[5-nitro-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cnco2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H20N4O4Si/c1-25(2,3)7-6-23-11-19-14-5-4-12(20(21)22)8-13(14)16(18-19)15-9-17-10-24-15/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | IQMCXWRFVDOFRU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|