C27H31N5O2Si — CID 168728047
1-[methyl-[3-(1,3-oxazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]amino]-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 168728047) has the molecular formula C27H31N5O2Si and a molecular weight of 485.66 g/mol. Its IUPAC name is 1-[methyl-[3-(1,3-oxazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]amino]-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 1-[methyl-[3-(1,3-oxazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]amino]-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 168728047 |
| Molecular Formula | C27H31N5O2Si |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-[methyl-[3-(1,3-oxazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]amino]-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | CN(c1ccc2c(c1)c(-c1cnco1)nn2COCC[Si](C)(C)C)C1CCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C27H31N5O2Si/c1-31(24-9-6-20-13-19(15-28)5-8-22(20)24)21-7-10-25-23(14-21)27(26-16-29-17-34-26)30-32(25)18-33-11-12-35(2,3)4/h5,7-8,10,13-14,16-17,24H,6,9,11-12,18H2,1-4H3 |
| InChIKey | KUZDTOBGRVKTLP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|