C21H19N5O — CID 156851052
1-[4-amino-N-methyl-3-(1,3-oxazole-5-carboximidoyl)anilino]-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 156851052) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-[4-amino-N-methyl-3-(1,3-oxazole-5-carboximidoyl)anilino]-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 1-[4-amino-N-methyl-3-(1,3-oxazole-5-carboximidoyl)anilino]-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 156851052 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[4-amino-N-methyl-3-(1,3-oxazole-5-carboximidoyl)anilino]-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | [H]/N=C(\c1cnco1)c1cc(N(C)C2CCc3cc(C#N)ccc32)ccc1N |
| InChI | InChI=1S/C21H19N5O/c1-26(19-7-3-14-8-13(10-22)2-5-16(14)19)15-4-6-18(23)17(9-15)21(24)20-11-25-12-27-20/h2,4-6,8-9,11-12,19,24H,3,7,23H2,1H3/b24-21- |
| InChIKey | YYFQIBHXEZMCPW-FLFQWRMESA-N |
| XLogP | 3.67 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|