C19H17F3N6O2 — CID 155574812
N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-5-cyano-3-methyl-4-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen (PubChem CID 155574812) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-5-cyano-3-methyl-4-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen.
| Compound Name | N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-5-cyano-3-methyl-4-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 155574812 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-5-cyano-3-methyl-4-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen |
| SMILES | [H]/N=C(\c1cnco1)c1cc(NC(=O)c2ncc(C#N)c(C(F)(F)F)c2C)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C19H13F3N6O2.2H2/c1-9-15(19(20,21)22)10(5-23)6-27-17(9)18(29)28-11-2-3-13(24)12(4-11)16(25)14-7-26-8-30-14;;/h2-4,6-8,25H,24H2,1H3,(H,28,29);2*1H/b25-16-;; |
| InChIKey | IYRURRZTVQQGMJ-DSHYBBOZSA-N |
| XLogP | 4.01 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|