C24H21N5O — CID 155482000
N-[4-amino-3-(3-cyclopropylbenzenecarboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 155482000) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is N-[4-amino-3-(3-cyclopropylbenzenecarboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(3-cyclopropylbenzenecarboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482000 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[4-amino-3-(3-cyclopropylbenzenecarboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1cccc(C2CC2)c1)c1cc(NC(=O)c2ncc(C#N)cc2C)ccc1N |
| InChI | InChI=1S/C24H21N5O/c1-14-9-15(12-25)13-28-23(14)24(30)29-19-7-8-21(26)20(11-19)22(27)18-4-2-3-17(10-18)16-5-6-16/h2-4,7-11,13,16,27H,5-6,26H2,1H3,(H,29,30)/b27-22+ |
| InChIKey | GEMOSNFFYPPSKJ-HPNDGRJYSA-N |
| XLogP | 4.39 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|