C17H11ClN6O2 — CID 155482677
N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-3-chloro-5-cyanopyridine-2-carboxamide (PubChem CID 155482677) has the molecular formula C17H11ClN6O2 and a molecular weight of 366.77 g/mol. Its IUPAC name is N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-3-chloro-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482677 |
| Molecular Formula | C17H11ClN6O2 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1cnoc1)c1cc(NC(=O)c2ncc(C#N)cc2Cl)ccc1N |
| InChI | InChI=1S/C17H11ClN6O2/c18-13-3-9(5-19)6-22-16(13)17(25)24-11-1-2-14(20)12(4-11)15(21)10-7-23-26-8-10/h1-4,6-8,21H,20H2,(H,24,25)/b21-15+ |
| InChIKey | FFMLXBAVJCTHFZ-RCCKNPSSSA-N |
| XLogP | 2.85 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|