C18H12ClN5O2 — CID 155481986
N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-chloro-5-cyanopyridine-2-carboxamide (PubChem CID 155481986) has the molecular formula C18H12ClN5O2 and a molecular weight of 365.78 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-chloro-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-chloro-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 155481986 |
| Molecular Formula | C18H12ClN5O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-chloro-5-cyanopyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)c2cc(Cl)c(C#N)cn2)ccc1N |
| InChI | InChI=1S/C18H12ClN5O2/c19-14-6-16(23-8-11(14)7-20)18(25)24-12-1-2-15(21)13(5-12)17(22)10-3-4-26-9-10/h1-6,8-9,22H,21H2,(H,24,25)/b22-17+ |
| InChIKey | BDGIGAIHPXAGPQ-OQKWZONESA-N |
| XLogP | 3.45 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|