C18H16N6O2 — CID 155575010
N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-4-cyano-1,3-dimethylpyrrole-2-carboxamide (PubChem CID 155575010) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-4-cyano-1,3-dimethylpyrrole-2-carboxamide.
| Compound Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-4-cyano-1,3-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155575010 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-4-cyano-1,3-dimethylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(\c1cnoc1)c1cc(NC(=O)c2c(C)c(C#N)cn2C)ccc1N |
| InChI | InChI=1S/C18H16N6O2/c1-10-11(6-19)8-24(2)17(10)18(25)23-13-3-4-15(20)14(5-13)16(21)12-7-22-26-9-12/h3-5,7-9,21H,20H2,1-2H3,(H,23,25)/b21-16+ |
| InChIKey | OKGAHKARTBZLKV-LTGZKZEYSA-N |
| XLogP | 2.44 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|