C22H20N6O2 — CID 155482657
N-[4-amino-3-(1-methyl-2-oxopyridine-3-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide (PubChem CID 155482657) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-amino-3-(1-methyl-2-oxopyridine-3-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(1-methyl-2-oxopyridine-3-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482657 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[4-amino-3-(1-methyl-2-oxopyridine-3-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide |
| SMILES | [H]/N=C(/c1cc(NC(=O)c2ncc(C#N)c(C)c2C)ccc1N)c1cccn(C)c1=O |
| InChI | InChI=1S/C22H20N6O2/c1-12-13(2)20(26-11-14(12)10-23)21(29)27-15-6-7-18(24)17(9-15)19(25)16-5-4-8-28(3)22(16)30/h4-9,11,25H,24H2,1-3H3,(H,27,29)/b25-19+ |
| InChIKey | WFYOWCAOLROPCJ-NCELDCMTSA-N |
| XLogP | 2.52 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|