C23H22N6O2 — CID 155482084
N-[4-amino-3-(5-propan-2-yloxypyridine-3-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 155482084) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[4-amino-3-(5-propan-2-yloxypyridine-3-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(5-propan-2-yloxypyridine-3-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482084 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[4-amino-3-(5-propan-2-yloxypyridine-3-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1cncc(OC(C)C)c1)c1cc(NC(=O)c2ncc(C#N)cc2C)ccc1N |
| InChI | InChI=1S/C23H22N6O2/c1-13(2)31-18-7-16(11-27-12-18)21(26)19-8-17(4-5-20(19)25)29-23(30)22-14(3)6-15(9-24)10-28-22/h4-8,10-13,26H,25H2,1-3H3,(H,29,30)/b26-21+ |
| InChIKey | NNMYUDYUGUAHSC-YYADALCUSA-N |
| XLogP | 3.69 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|