C18H17N5O — CID 155482411
N-(4-amino-3-ethanimidoylphenyl)-5-cyano-3-prop-1-en-2-ylpyridine-2-carboxamide (PubChem CID 155482411) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-(4-amino-3-ethanimidoylphenyl)-5-cyano-3-prop-1-en-2-ylpyridine-2-carboxamide.
| Compound Name | N-(4-amino-3-ethanimidoylphenyl)-5-cyano-3-prop-1-en-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482411 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(4-amino-3-ethanimidoylphenyl)-5-cyano-3-prop-1-en-2-ylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\C)c1cc(NC(=O)c2ncc(C#N)cc2C(=C)C)ccc1N |
| InChI | InChI=1S/C18H17N5O/c1-10(2)14-6-12(8-19)9-22-17(14)18(24)23-13-4-5-16(21)15(7-13)11(3)20/h4-7,9,20H,1,21H2,2-3H3,(H,23,24)/b20-11+ |
| InChIKey | XEDUYXDBLQQRPN-RGVLZGJSSA-N |
| XLogP | 3.21 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|