C21H18N6O — CID 155481963
N-[4-amino-3-(6-methylpyridine-2-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 155481963) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[4-amino-3-(6-methylpyridine-2-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(6-methylpyridine-2-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155481963 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[4-amino-3-(6-methylpyridine-2-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1cccc(C)n1)c1cc(NC(=O)c2ncc(C#N)cc2C)ccc1N |
| InChI | InChI=1S/C21H18N6O/c1-12-8-14(10-22)11-25-20(12)21(28)27-15-6-7-17(23)16(9-15)19(24)18-5-3-4-13(2)26-18/h3-9,11,24H,23H2,1-2H3,(H,27,28)/b24-19- |
| InChIKey | DMFGIDHCURJLEB-CLCOLTQESA-N |
| XLogP | 3.22 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|