C20H16N7O+ — CID 176517176
N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridin-1-ium-2-carboxamide (PubChem CID 176517176) has the molecular formula C20H16N7O+ and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 176517176 |
| Molecular Formula | C20H16N7O+ |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-5-cyano-3,4-dimethylpyridin-1-ium-2-carboxamide |
| SMILES | [H]/N=C(\c1ccncn1)c1cc(NC(=O)C2=[N+]=C=C(C#N)C(C)=C2C)ccc1N |
| InChI | InChI=1S/C20H15N7O/c1-11-12(2)19(25-9-13(11)8-21)20(28)27-14-3-4-16(22)15(7-14)18(23)17-5-6-24-10-26-17/h3-7,10,22-23,28H,1-2H3/p+1/b23-18- |
| InChIKey | UYRYDVPWNUZHHI-NKFKGCMQSA-O |
| XLogP | 1.39 |
| TPSA | 142.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|