C19H16N6O2 — CID 155481751
N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-2-cyano-3-ethylpyridine-4-carboxamide (PubChem CID 155481751) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-2-cyano-3-ethylpyridine-4-carboxamide.
| Compound Name | N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-2-cyano-3-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 155481751 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[4-amino-3-(1,3-oxazole-5-carboximidoyl)phenyl]-2-cyano-3-ethylpyridine-4-carboxamide |
| SMILES | [H]/N=C(\c1cnco1)c1cc(NC(=O)c2ccnc(C#N)c2CC)ccc1N |
| InChI | InChI=1S/C19H16N6O2/c1-2-12-13(5-6-24-16(12)8-20)19(26)25-11-3-4-15(21)14(7-11)18(22)17-9-23-10-27-17/h3-7,9-10,22H,2,21H2,1H3,(H,25,26)/b22-18- |
| InChIKey | PQHIYVHZFPXIBT-PYCFMQQDSA-N |
| XLogP | 2.75 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|