C20H20N6O — CID 155134753
3,4-diamino-N-[4-amino-3-(pyridine-4-carboximidoyl)phenyl]-2-methylbenzamide (PubChem CID 155134753) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 3,4-diamino-N-[4-amino-3-(pyridine-4-carboximidoyl)phenyl]-2-methylbenzamide.
| Compound Name | 3,4-diamino-N-[4-amino-3-(pyridine-4-carboximidoyl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 155134753 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3,4-diamino-N-[4-amino-3-(pyridine-4-carboximidoyl)phenyl]-2-methylbenzamide |
| SMILES | [H]/N=C(\c1ccncc1)c1cc(NC(=O)c2ccc(N)c(N)c2C)ccc1N |
| InChI | InChI=1S/C20H20N6O/c1-11-14(3-5-17(22)18(11)23)20(27)26-13-2-4-16(21)15(10-13)19(24)12-6-8-25-9-7-12/h2-10,24H,21-23H2,1H3,(H,26,27)/b24-19+ |
| InChIKey | OCNNZAUHJNMZAI-LYBHJNIJSA-N |
| XLogP | 2.81 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|