C14H15N5 — CID 139472490
4-N-[(Z)-2-aminoethenyl]-2-(pyridine-4-carboximidoyl)benzene-1,4-diamine (PubChem CID 139472490) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-N-[(Z)-2-aminoethenyl]-2-(pyridine-4-carboximidoyl)benzene-1,4-diamine.
| Compound Name | 4-N-[(Z)-2-aminoethenyl]-2-(pyridine-4-carboximidoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 139472490 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-N-[(Z)-2-aminoethenyl]-2-(pyridine-4-carboximidoyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1ccncc1)c1cc(N/C=C\N)ccc1N |
| InChI | InChI=1S/C14H15N5/c15-5-8-19-11-1-2-13(16)12(9-11)14(17)10-3-6-18-7-4-10/h1-9,17,19H,15-16H2/b8-5-,17-14+ |
| InChIKey | BTSAYGJYQCCOGO-AQLLZYMMSA-N |
| XLogP | 1.92 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|