C18H18N6 — CID 143557530
4-N-[4-amino-3-(3-methylbenzenecarboximidoyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 143557530) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-N-[4-amino-3-(3-methylbenzenecarboximidoyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-amino-3-(3-methylbenzenecarboximidoyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557530 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-N-[4-amino-3-(3-methylbenzenecarboximidoyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | [H]/N=C(\c1cccc(C)c1)c1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C18H18N6/c1-11-3-2-4-12(9-11)17(20)14-10-13(5-6-15(14)19)23-16-7-8-22-18(21)24-16/h2-10,20H,19H2,1H3,(H3,21,22,23,24)/b20-17+ |
| InChIKey | OQXIJKXRUCQOTF-LVZFUZTISA-N |
| XLogP | 3.11 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|