C11H11IN6 — CID 143557243
2-amino-5-[(2-aminopyrimidin-4-yl)amino]benzenecarboximidoyl iodide (PubChem CID 143557243) has the molecular formula C11H11IN6 and a molecular weight of 354.16 g/mol. Its IUPAC name is 2-amino-5-[(2-aminopyrimidin-4-yl)amino]benzenecarboximidoyl iodide.
| Compound Name | 2-amino-5-[(2-aminopyrimidin-4-yl)amino]benzenecarboximidoyl iodide |
|---|---|
| PubChem CID | 143557243 |
| Molecular Formula | C11H11IN6 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-amino-5-[(2-aminopyrimidin-4-yl)amino]benzenecarboximidoyl iodide |
| SMILES | [H]/N=C(\I)c1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C11H11IN6/c12-10(14)7-5-6(1-2-8(7)13)17-9-3-4-16-11(15)18-9/h1-5,14H,13H2,(H3,15,16,17,18)/b14-10- |
| InChIKey | SXSXZVXOTVFWGW-UVTDQMKNSA-N |
| XLogP | 2.14 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|