C16H26N6O2 — CID 143557339
4-N-(4-amino-3-ethanimidoylphenyl)pyrimidine-2,4-diamine;ethane;ethane-1,1-diol (PubChem CID 143557339) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-N-(4-amino-3-ethanimidoylphenyl)pyrimidine-2,4-diamine;ethane;ethane-1,1-diol.
| Compound Name | 4-N-(4-amino-3-ethanimidoylphenyl)pyrimidine-2,4-diamine;ethane;ethane-1,1-diol |
|---|---|
| PubChem CID | 143557339 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-N-(4-amino-3-ethanimidoylphenyl)pyrimidine-2,4-diamine;ethane;ethane-1,1-diol |
| SMILES | CC.CC(O)O.[H]/N=C(\C)c1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C12H14N6.C2H6O2.C2H6/c1-7(13)9-6-8(2-3-10(9)14)17-11-4-5-16-12(15)18-11;1-2(3)4;1-2/h2-6,13H,14H2,1H3,(H3,15,16,17,18);2-4H,1H3;1-2H3/b13-7+;; |
| InChIKey | LCKKFUXPXUKGSJ-JOZOFPPJSA-N |
| XLogP | 2.12 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|