C23H23N7O2 — CID 143557307
2-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]phenyl]-2-imino-N-(4-methoxy-1,2-dihydronaphthalen-2-yl)acetamide (PubChem CID 143557307) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]phenyl]-2-imino-N-(4-methoxy-1,2-dihydronaphthalen-2-yl)acetamide.
| Compound Name | 2-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]phenyl]-2-imino-N-(4-methoxy-1,2-dihydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 143557307 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[2-amino-5-[(2-aminopyrimidin-4-yl)amino]phenyl]-2-imino-N-(4-methoxy-1,2-dihydronaphthalen-2-yl)acetamide |
| SMILES | [H]/N=C(\C(=O)NC1C=C(OC)c2ccccc2C1)c1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C23H23N7O2/c1-32-19-12-15(10-13-4-2-3-5-16(13)19)29-22(31)21(25)17-11-14(6-7-18(17)24)28-20-8-9-27-23(26)30-20/h2-9,11-12,15,25H,10,24H2,1H3,(H,29,31)(H3,26,27,28,30)/b25-21- |
| InChIKey | DRKHLFXTMBZEKO-DAFNUICNSA-N |
| XLogP | 2.48 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|