C11H13N5 — CID 143557696
4-N-(4-amino-3-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 143557696) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-N-(4-amino-3-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-amino-3-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143557696 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4-N-(4-amino-3-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccnc(N)n2)ccc1N |
| InChI | InChI=1S/C11H13N5/c1-7-6-8(2-3-9(7)12)15-10-4-5-14-11(13)16-10/h2-6H,12H2,1H3,(H3,13,14,15,16) |
| InChIKey | AFCITQOLIWRRGN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|