C13H16ClN5O — CID 160584950
N-[4-[(2-aminopyrimidin-4-yl)amino]-3-methylphenyl]acetamide;hydrochloride (PubChem CID 160584950) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is N-[4-[(2-aminopyrimidin-4-yl)amino]-3-methylphenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[(2-aminopyrimidin-4-yl)amino]-3-methylphenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 160584950 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[4-[(2-aminopyrimidin-4-yl)amino]-3-methylphenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(Nc2ccnc(N)n2)c(C)c1.Cl |
| InChI | InChI=1S/C13H15N5O.ClH/c1-8-7-10(16-9(2)19)3-4-11(8)17-12-5-6-15-13(14)18-12;/h3-7H,1-2H3,(H,16,19)(H3,14,15,17,18);1H |
| InChIKey | AZIPYVLJEKCXJE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |