C15H18ClN3O — CID 145490179
N-[4-(2-chloropyrimidin-4-yl)-3-methylphenyl]acetamide;ethane (PubChem CID 145490179) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[4-(2-chloropyrimidin-4-yl)-3-methylphenyl]acetamide;ethane.
| Compound Name | N-[4-(2-chloropyrimidin-4-yl)-3-methylphenyl]acetamide;ethane |
|---|---|
| PubChem CID | 145490179 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[4-(2-chloropyrimidin-4-yl)-3-methylphenyl]acetamide;ethane |
| SMILES | CC.CC(=O)Nc1ccc(-c2ccnc(Cl)n2)c(C)c1 |
| InChI | InChI=1S/C13H12ClN3O.C2H6/c1-8-7-10(16-9(2)18)3-4-11(8)12-5-6-15-13(14)17-12;1-2/h3-7H,1-2H3,(H,16,18);1-2H3 |
| InChIKey | OUANZFAKODEGOG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |