7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid

C20H18N2O3 — CID 18073634

IUPAC7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid
SMILESCC(=O)Nc1ccc2c(C(=O)O)cc(-c3ccc(C)cc3C)nc2c1
InChIInChI=1S/C20H18N2O3/c1-11-4-6-15(12(2)8-11)19-10-17(20(24)25)16-7-5-14(21-13(3)23)9-18(16)22-19/h4-10H,1-3H3,(H,21,23)(H,24,25)
InChIKeyUZZCEFXFVNNAJB-UHFFFAOYSA-N
MW334.38 g/mol
LogP4.18
Rot. Bonds3

About 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid

7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid (PubChem CID 18073634) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid.

Molecular Properties

Compound Name7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid
PubChem CID18073634
Molecular FormulaC20H18N2O3
Molecular Weight334.38 g/mol
Exact Mass334.13
IUPAC Name7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid
SMILESCC(=O)Nc1ccc2c(C(=O)O)cc(-c3ccc(C)cc3C)nc2c1
InChIInChI=1S/C20H18N2O3/c1-11-4-6-15(12(2)8-11)19-10-17(20(24)25)16-7-5-14(21-13(3)23)9-18(16)22-19/h4-10H,1-3H3,(H,21,23)(H,24,25)
InChIKeyUZZCEFXFVNNAJB-UHFFFAOYSA-N
XLogP4.18
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.38
LogP ≤ 54.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid?
The IUPAC name of 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid (CID 18073634) is 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid.
What is the SMILES notation for 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid?
The canonical SMILES for 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid is CC(=O)Nc1ccc2c(C(=O)O)cc(-c3ccc(C)cc3C)nc2c1.
What is the InChIKey of 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid?
The InChIKey is UZZCEFXFVNNAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-11-4-6-15(12(2)8-11)19-10-17(20(24)25)16-7-5-14(21-13(3)23)9-18(16)22-19/h4-10H,1-3H3,(H,21,23)(H,24,25).
What are the key properties of 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid?
7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid has a molecular weight of 334.38 g/mol, XLogP of 4.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetamido-2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid is sourced from PubChem (CID 18073634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).