C25H20Cl2N4O2 — CID 994737
1-(3,4-dichlorophenyl)-3-[[2-(2,4-dimethylphenyl)quinoline-4-carbonyl]amino]urea (PubChem CID 994737) has the molecular formula C25H20Cl2N4O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[[2-(2,4-dimethylphenyl)quinoline-4-carbonyl]amino]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[[2-(2,4-dimethylphenyl)quinoline-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 994737 |
| Molecular Formula | C25H20Cl2N4O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[[2-(2,4-dimethylphenyl)quinoline-4-carbonyl]amino]urea |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)Nc3ccc(Cl)c(Cl)c3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C25H20Cl2N4O2/c1-14-7-9-17(15(2)11-14)23-13-19(18-5-3-4-6-22(18)29-23)24(32)30-31-25(33)28-16-8-10-20(26)21(27)12-16/h3-13H,1-2H3,(H,30,32)(H2,28,31,33) |
| InChIKey | FMIXTFXMAOBIRA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|