C28H24FN5O3 — CID 171466105
1-N'-[4-[3-(2-aminopyrimidin-4-yl)-4-hydroxyphenyl]-3-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 171466105) has the molecular formula C28H24FN5O3 and a molecular weight of 497.53 g/mol. Its IUPAC name is 1-N'-[4-[3-(2-aminopyrimidin-4-yl)-4-hydroxyphenyl]-3-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[3-(2-aminopyrimidin-4-yl)-4-hydroxyphenyl]-3-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 171466105 |
| Molecular Formula | C28H24FN5O3 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 1-N'-[4-[3-(2-aminopyrimidin-4-yl)-4-hydroxyphenyl]-3-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)ccc1-c1ccc(O)c(-c2ccnc(N)n2)c1 |
| InChI | InChI=1S/C28H24FN5O3/c1-16-14-20(33-26(37)28(11-12-28)25(36)32-19-5-3-18(29)4-6-19)7-8-21(16)17-2-9-24(35)22(15-17)23-10-13-31-27(30)34-23/h2-10,13-15,35H,11-12H2,1H3,(H,32,36)(H,33,37)(H2,30,31,34) |
| InChIKey | IIJSBRVXUDKAEK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|