C27H23F2N7O2 — CID 169075179
1-N'-[4-fluoro-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 169075179) has the molecular formula C27H23F2N7O2 and a molecular weight of 515.52 g/mol. Its IUPAC name is 1-N'-[4-fluoro-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-fluoro-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 169075179 |
| Molecular Formula | C27H23F2N7O2 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 1-N'-[4-fluoro-3-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | C/N=c1\ncc2cc(-c3cc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)ccc3F)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C27H23F2N7O2/c1-30-26-32-14-15-12-20(23-31-10-11-36(23)22(15)35-26)19-13-18(6-7-21(19)29)34-25(38)27(8-9-27)24(37)33-17-4-2-16(28)3-5-17/h2-7,12-14,31H,8-11H2,1H3,(H,33,37)(H,34,38)/b30-26+ |
| InChIKey | UZZVFHKISSMVAA-URGPHPNLSA-N |
| XLogP | 3.64 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|