C11H11FN2O2 — CID 58987988
1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 58987988) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 58987988 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C11H11FN2O2/c12-7-1-3-8(4-2-7)14-10(16)11(5-6-11)9(13)15/h1-4H,5-6H2,(H2,13,15)(H,14,16) |
| InChIKey | WHTYLRLZUGABTR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|