C17H15FN2O3S — CID 144712460
1-N'-(4-fluorophenyl)-1-N-(4-sulfanyloxyphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 144712460) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-(4-sulfanyloxyphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-(4-sulfanyloxyphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144712460 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-(4-sulfanyloxyphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(C(=O)Nc2ccc(OS)cc2)CC1 |
| InChI | InChI=1S/C17H15FN2O3S/c18-11-1-3-12(4-2-11)19-15(21)17(9-10-17)16(22)20-13-5-7-14(23-24)8-6-13/h1-8,24H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | WMXZZZMWKBICFA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|