C18H14FN3O2 — CID 108982432
1-N'-(2-cyanophenyl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108982432) has the molecular formula C18H14FN3O2 and a molecular weight of 323.33 g/mol. Its IUPAC name is 1-N'-(2-cyanophenyl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2-cyanophenyl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982432 |
| Molecular Formula | C18H14FN3O2 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-N'-(2-cyanophenyl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H14FN3O2/c19-13-5-7-14(8-6-13)21-16(23)18(9-10-18)17(24)22-15-4-2-1-3-12(15)11-20/h1-8H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | YDFBNWODTJFHJL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|