C16H14FN5O — CID 164863272
4-(4-amino-3-fluoroanilino)-2-(2-aminopyrimidin-4-yl)phenol (PubChem CID 164863272) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-(4-amino-3-fluoroanilino)-2-(2-aminopyrimidin-4-yl)phenol.
| Compound Name | 4-(4-amino-3-fluoroanilino)-2-(2-aminopyrimidin-4-yl)phenol |
|---|---|
| PubChem CID | 164863272 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(4-amino-3-fluoroanilino)-2-(2-aminopyrimidin-4-yl)phenol |
| SMILES | Nc1nccc(-c2cc(Nc3ccc(N)c(F)c3)ccc2O)n1 |
| InChI | InChI=1S/C16H14FN5O/c17-12-8-10(1-3-13(12)18)21-9-2-4-15(23)11(7-9)14-5-6-20-16(19)22-14/h1-8,21,23H,18H2,(H2,19,20,22) |
| InChIKey | MRQKOTDIBJFRHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|