C10H8ClN3O — CID 135905112
2-(2-aminopyrimidin-4-yl)-4-chlorophenol (PubChem CID 135905112) has the molecular formula C10H8ClN3O and a molecular weight of 221.65 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-4-chlorophenol.
| Compound Name | 2-(2-aminopyrimidin-4-yl)-4-chlorophenol |
|---|---|
| PubChem CID | 135905112 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-4-chlorophenol |
| SMILES | Nc1nccc(-c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C10H8ClN3O/c11-6-1-2-9(15)7(5-6)8-3-4-13-10(12)14-8/h1-5,15H,(H2,12,13,14) |
| InChIKey | DWDQNNFLFWSVJI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |