C10H10ClN5O — CID 137035550
2-[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]-4-chlorophenol (PubChem CID 137035550) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 2-[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]-4-chlorophenol.
| Compound Name | 2-[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 137035550 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]-4-chlorophenol |
| SMILES | CNc1nc(N)nc(-c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C10H10ClN5O/c1-13-10-15-8(14-9(12)16-10)6-4-5(11)2-3-7(6)17/h2-4,17H,1H3,(H3,12,13,14,15,16) |
| InChIKey | GNZSQZKPAPYMRR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |