C16H14ClN5O2 — CID 10246865
4-[[4-amino-6-(5-chloro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 10246865) has the molecular formula C16H14ClN5O2 and a molecular weight of 343.77 g/mol. Its IUPAC name is 4-[[4-amino-6-(5-chloro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 4-[[4-amino-6-(5-chloro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 10246865 |
| Molecular Formula | C16H14ClN5O2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-[[4-amino-6-(5-chloro-2-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | COc1ccc(Cl)cc1-c1nc(N)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C16H14ClN5O2/c1-24-13-7-2-9(17)8-12(13)14-20-15(18)22-16(21-14)19-10-3-5-11(23)6-4-10/h2-8,23H,1H3,(H3,18,19,20,21,22) |
| InChIKey | CFSPXSRPSNVZCV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|