About 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol (PubChem CID 59860984) has the molecular formula C10H9ClN4O2
and a molecular weight of 252.66 g/mol. Its IUPAC name is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol.
Molecular Properties
| Compound Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol |
| PubChem CID | 59860984 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol |
| SMILES | COc1nc(Cl)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H9ClN4O2/c1-17-10-14-8(11)13-9(15-10)12-6-2-4-7(16)5-3-6/h2-5,16H,1H3,(H,12,13,14,15) |
| InChIKey | FKENTYLJLANAOS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol?
The IUPAC name of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol (CID 59860984) is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol.
What is the SMILES notation for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol?
The canonical SMILES for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol is COc1nc(Cl)nc(Nc2ccc(O)cc2)n1.
What is the InChIKey of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol?
The InChIKey is FKENTYLJLANAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4O2/c1-17-10-14-8(11)13-9(15-10)12-6-2-4-7(16)5-3-6/h2-5,16H,1H3,(H,12,13,14,15).
What are the key properties of 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol?
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol has a molecular weight of 252.66 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol is sourced from PubChem (CID 59860984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).