C10H9ClN4O2 — CID 59860984
4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol (PubChem CID 59860984) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol.
| Compound Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 59860984 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]phenol |
| SMILES | COc1nc(Cl)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H9ClN4O2/c1-17-10-14-8(11)13-9(15-10)12-6-2-4-7(16)5-3-6/h2-5,16H,1H3,(H,12,13,14,15) |
| InChIKey | FKENTYLJLANAOS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|